C24H22N4O6S2 — CID 4310384
3-(4-morpholin-4-ylsulfonylanilino)-1-(4-nitrophenyl)-2-pyridin-1-ium-1-yl-3-sulfanylideneprop-1-en-1-olate (PubChem CID 4310384) has the molecular formula C24H22N4O6S2 and a molecular weight of 526.60 g/mol. Its IUPAC name is 3-(4-morpholin-4-ylsulfonylanilino)-1-(4-nitrophenyl)-2-pyridin-1-ium-1-yl-3-sulfanylideneprop-1-en-1-olate.
| Compound Name | 3-(4-morpholin-4-ylsulfonylanilino)-1-(4-nitrophenyl)-2-pyridin-1-ium-1-yl-3-sulfanylideneprop-1-en-1-olate |
|---|---|
| PubChem CID | 4310384 |
| Molecular Formula | C24H22N4O6S2 |
| Molecular Weight | 526.60 g/mol |
| Exact Mass | 526.10 |
| IUPAC Name | 3-(4-morpholin-4-ylsulfonylanilino)-1-(4-nitrophenyl)-2-pyridin-1-ium-1-yl-3-sulfanylideneprop-1-en-1-olate |
| SMILES | O=[N+]([O-])c1ccc(C([O-])=C(C(=S)Nc2ccc(S(=O)(=O)N3CCOCC3)cc2)[n+]2ccccc2)cc1 |
| InChI | InChI=1S/C24H22N4O6S2/c29-23(18-4-8-20(9-5-18)28(30)31)22(26-12-2-1-3-13-26)24(35)25-19-6-10-21(11-7-19)36(32,33)27-14-16-34-17-15-27/h1-13H,14-17H2,(H-,25,29,35) |
| InChIKey | JPVLSXDTXKJBRJ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 128.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.60 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|