C17H17Cl2N2OS+ — CID 8653578
3-(3,4-dichlorophenyl)-N-ethyl-2-(3-methylpyridin-1-ium-1-yl)-3-oxopropanethioamide (PubChem CID 8653578) has the molecular formula C17H17Cl2N2OS+ and a molecular weight of 368.31 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-N-ethyl-2-(3-methylpyridin-1-ium-1-yl)-3-oxopropanethioamide.
| Compound Name | 3-(3,4-dichlorophenyl)-N-ethyl-2-(3-methylpyridin-1-ium-1-yl)-3-oxopropanethioamide |
|---|---|
| PubChem CID | 8653578 |
| Molecular Formula | C17H17Cl2N2OS+ |
| Molecular Weight | 368.31 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-N-ethyl-2-(3-methylpyridin-1-ium-1-yl)-3-oxopropanethioamide |
| SMILES | CCNC(=S)C(C(=O)c1ccc(Cl)c(Cl)c1)[n+]1cccc(C)c1 |
| InChI | InChI=1S/C17H16Cl2N2OS/c1-3-20-17(23)15(21-8-4-5-11(2)10-21)16(22)12-6-7-13(18)14(19)9-12/h4-10,15H,3H2,1-2H3/p+1 |
| InChIKey | ZJMQQCVHSHDJFX-UHFFFAOYSA-O |
| XLogP | 3.95 |
| TPSA | 32.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.31 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|