C19H23N2OS2+ — CID 135847792
(2S)-2-(4-tert-butylpyridin-1-ium-1-yl)-3-oxo-N-prop-2-enyl-3-thiophen-2-ylpropanethioamide (PubChem CID 135847792) has the molecular formula C19H23N2OS2+ and a molecular weight of 359.54 g/mol. Its IUPAC name is (2S)-2-(4-tert-butylpyridin-1-ium-1-yl)-3-oxo-N-prop-2-enyl-3-thiophen-2-ylpropanethioamide.
| Compound Name | (2S)-2-(4-tert-butylpyridin-1-ium-1-yl)-3-oxo-N-prop-2-enyl-3-thiophen-2-ylpropanethioamide |
|---|---|
| PubChem CID | 135847792 |
| Molecular Formula | C19H23N2OS2+ |
| Molecular Weight | 359.54 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | (2S)-2-(4-tert-butylpyridin-1-ium-1-yl)-3-oxo-N-prop-2-enyl-3-thiophen-2-ylpropanethioamide |
| SMILES | C=CCNC(=S)[C@H](C(=O)c1cccs1)[n+]1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H22N2OS2/c1-5-10-20-18(23)16(17(22)15-7-6-13-24-15)21-11-8-14(9-12-21)19(2,3)4/h5-9,11-13,16H,1,10H2,2-4H3/p+1/t16-/m0/s1 |
| InChIKey | IXYSVEHLKQIWPZ-INIZCTEOSA-O |
| XLogP | 3.86 |
| TPSA | 32.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.54 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|