C19H22N2OS2 — CID 135847791
(2S)-2-(4-tert-butylpyridin-1-ium-1-yl)-3-oxo-N-prop-2-enyl-3-thiophen-2-ylpropanimidothioate (PubChem CID 135847791) has the molecular formula C19H22N2OS2 and a molecular weight of 358.53 g/mol. Its IUPAC name is (2S)-2-(4-tert-butylpyridin-1-ium-1-yl)-3-oxo-N-prop-2-enyl-3-thiophen-2-ylpropanimidothioate.
| Compound Name | (2S)-2-(4-tert-butylpyridin-1-ium-1-yl)-3-oxo-N-prop-2-enyl-3-thiophen-2-ylpropanimidothioate |
|---|---|
| PubChem CID | 135847791 |
| Molecular Formula | C19H22N2OS2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | (2S)-2-(4-tert-butylpyridin-1-ium-1-yl)-3-oxo-N-prop-2-enyl-3-thiophen-2-ylpropanimidothioate |
| SMILES | C=CC/N=C(\[S-])[C@H](C(=O)c1cccs1)[n+]1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H22N2OS2/c1-5-10-20-18(23)16(17(22)15-7-6-13-24-15)21-11-8-14(9-12-21)19(2,3)4/h5-9,11-13,16H,1,10H2,2-4H3/t16-/m0/s1 |
| InChIKey | IXYSVEHLKQIWPZ-INIZCTEOSA-N |
| XLogP | 3.89 |
| TPSA | 33.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|