C19H24N2OS2 — CID 8653780
(2S)-N-ethyl-3-oxo-2-(4-pentan-3-ylpyridin-1-ium-1-yl)-3-thiophen-2-ylpropanimidothioate (PubChem CID 8653780) has the molecular formula C19H24N2OS2 and a molecular weight of 360.55 g/mol. Its IUPAC name is (2S)-N-ethyl-3-oxo-2-(4-pentan-3-ylpyridin-1-ium-1-yl)-3-thiophen-2-ylpropanimidothioate.
| Compound Name | (2S)-N-ethyl-3-oxo-2-(4-pentan-3-ylpyridin-1-ium-1-yl)-3-thiophen-2-ylpropanimidothioate |
|---|---|
| PubChem CID | 8653780 |
| Molecular Formula | C19H24N2OS2 |
| Molecular Weight | 360.55 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | (2S)-N-ethyl-3-oxo-2-(4-pentan-3-ylpyridin-1-ium-1-yl)-3-thiophen-2-ylpropanimidothioate |
| SMILES | CC/N=C(\[S-])[C@H](C(=O)c1cccs1)[n+]1ccc(C(CC)CC)cc1 |
| InChI | InChI=1S/C19H24N2OS2/c1-4-14(5-2)15-9-11-21(12-10-15)17(19(23)20-6-3)18(22)16-8-7-13-24-16/h7-14,17H,4-6H2,1-3H3/t17-/m0/s1 |
| InChIKey | QFFXCEZBLUDUEO-KRWDZBQOSA-N |
| XLogP | 4.33 |
| TPSA | 33.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.55 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|