C19H21ClN2OS — CID 23375508
(2S)-3-(2-chlorophenyl)-N-ethyl-3-oxo-2-(4-propylpyridin-1-ium-1-yl)propanimidothioate (PubChem CID 23375508) has the molecular formula C19H21ClN2OS and a molecular weight of 360.91 g/mol. Its IUPAC name is (2S)-3-(2-chlorophenyl)-N-ethyl-3-oxo-2-(4-propylpyridin-1-ium-1-yl)propanimidothioate.
| Compound Name | (2S)-3-(2-chlorophenyl)-N-ethyl-3-oxo-2-(4-propylpyridin-1-ium-1-yl)propanimidothioate |
|---|---|
| PubChem CID | 23375508 |
| Molecular Formula | C19H21ClN2OS |
| Molecular Weight | 360.91 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | (2S)-3-(2-chlorophenyl)-N-ethyl-3-oxo-2-(4-propylpyridin-1-ium-1-yl)propanimidothioate |
| SMILES | CCCc1cc[n+]([C@@H](C(=O)c2ccccc2Cl)/C([S-])=N/CC)cc1 |
| InChI | InChI=1S/C19H21ClN2OS/c1-3-7-14-10-12-22(13-11-14)17(19(24)21-4-2)18(23)15-8-5-6-9-16(15)20/h5-6,8-13,17H,3-4,7H2,1-2H3/t17-/m0/s1 |
| InChIKey | VDMPLKIHXZMQNJ-KRWDZBQOSA-N |
| XLogP | 3.97 |
| TPSA | 33.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.91 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|