C19H22ClN2OS+ — CID 23375509
(2S)-3-(2-chlorophenyl)-N-ethyl-3-oxo-2-(4-propylpyridin-1-ium-1-yl)propanethioamide (PubChem CID 23375509) has the molecular formula C19H22ClN2OS+ and a molecular weight of 361.92 g/mol. Its IUPAC name is (2S)-3-(2-chlorophenyl)-N-ethyl-3-oxo-2-(4-propylpyridin-1-ium-1-yl)propanethioamide.
| Compound Name | (2S)-3-(2-chlorophenyl)-N-ethyl-3-oxo-2-(4-propylpyridin-1-ium-1-yl)propanethioamide |
|---|---|
| PubChem CID | 23375509 |
| Molecular Formula | C19H22ClN2OS+ |
| Molecular Weight | 361.92 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | (2S)-3-(2-chlorophenyl)-N-ethyl-3-oxo-2-(4-propylpyridin-1-ium-1-yl)propanethioamide |
| SMILES | CCCc1cc[n+]([C@@H](C(=O)c2ccccc2Cl)C(=S)NCC)cc1 |
| InChI | InChI=1S/C19H21ClN2OS/c1-3-7-14-10-12-22(13-11-14)17(19(24)21-4-2)18(23)15-8-5-6-9-16(15)20/h5-6,8-13,17H,3-4,7H2,1-2H3/p+1/t17-/m0/s1 |
| InChIKey | VDMPLKIHXZMQNJ-KRWDZBQOSA-O |
| XLogP | 3.94 |
| TPSA | 32.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.92 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|