C18H22ClN2O+ — CID 8877328
N-[2-(4-chlorophenyl)ethyl]-2-(4-propylpyridin-1-ium-1-yl)acetamide (PubChem CID 8877328) has the molecular formula C18H22ClN2O+ and a molecular weight of 317.84 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-2-(4-propylpyridin-1-ium-1-yl)acetamide.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-2-(4-propylpyridin-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 8877328 |
| Molecular Formula | C18H22ClN2O+ |
| Molecular Weight | 317.84 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-2-(4-propylpyridin-1-ium-1-yl)acetamide |
| SMILES | CCCc1cc[n+](CC(=O)NCCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C18H21ClN2O/c1-2-3-15-9-12-21(13-10-15)14-18(22)20-11-8-16-4-6-17(19)7-5-16/h4-7,9-10,12-13H,2-3,8,11,14H2,1H3/p+1 |
| InChIKey | IEZWZRVPCMRVAM-UHFFFAOYSA-O |
| XLogP | 2.94 |
| TPSA | 32.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.84 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|