C19H22BrN2OS+ — CID 8653733
(2S)-3-(2-bromophenyl)-N-ethyl-3-oxo-2-(4-propylpyridin-1-ium-1-yl)propanethioamide (PubChem CID 8653733) has the molecular formula C19H22BrN2OS+ and a molecular weight of 406.37 g/mol. Its IUPAC name is (2S)-3-(2-bromophenyl)-N-ethyl-3-oxo-2-(4-propylpyridin-1-ium-1-yl)propanethioamide.
| Compound Name | (2S)-3-(2-bromophenyl)-N-ethyl-3-oxo-2-(4-propylpyridin-1-ium-1-yl)propanethioamide |
|---|---|
| PubChem CID | 8653733 |
| Molecular Formula | C19H22BrN2OS+ |
| Molecular Weight | 406.37 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | (2S)-3-(2-bromophenyl)-N-ethyl-3-oxo-2-(4-propylpyridin-1-ium-1-yl)propanethioamide |
| SMILES | CCCc1cc[n+]([C@@H](C(=O)c2ccccc2Br)C(=S)NCC)cc1 |
| InChI | InChI=1S/C19H21BrN2OS/c1-3-7-14-10-12-22(13-11-14)17(19(24)21-4-2)18(23)15-8-5-6-9-16(15)20/h5-6,8-13,17H,3-4,7H2,1-2H3/p+1/t17-/m0/s1 |
| InChIKey | IKQLHJYBXFQQGC-KRWDZBQOSA-O |
| XLogP | 4.05 |
| TPSA | 32.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.37 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|