C17H20ClN2OS2+ — CID 122407082
(2R)-3-(5-chlorothiophen-2-yl)-N-ethyl-3-oxo-2-(4-propylpyridin-1-ium-1-yl)propanethioamide (PubChem CID 122407082) has the molecular formula C17H20ClN2OS2+ and a molecular weight of 367.95 g/mol. Its IUPAC name is (2R)-3-(5-chlorothiophen-2-yl)-N-ethyl-3-oxo-2-(4-propylpyridin-1-ium-1-yl)propanethioamide.
| Compound Name | (2R)-3-(5-chlorothiophen-2-yl)-N-ethyl-3-oxo-2-(4-propylpyridin-1-ium-1-yl)propanethioamide |
|---|---|
| PubChem CID | 122407082 |
| Molecular Formula | C17H20ClN2OS2+ |
| Molecular Weight | 367.95 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | (2R)-3-(5-chlorothiophen-2-yl)-N-ethyl-3-oxo-2-(4-propylpyridin-1-ium-1-yl)propanethioamide |
| SMILES | CCCc1cc[n+]([C@H](C(=O)c2ccc(Cl)s2)C(=S)NCC)cc1 |
| InChI | InChI=1S/C17H19ClN2OS2/c1-3-5-12-8-10-20(11-9-12)15(17(22)19-4-2)16(21)13-6-7-14(18)23-13/h6-11,15H,3-5H2,1-2H3/p+1/t15-/m1/s1 |
| InChIKey | UOUWMBHRSQHTCB-OAHLLOKOSA-O |
| XLogP | 4.00 |
| TPSA | 32.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.95 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|