C12H16ClNO2S2 — CID 114234090
2-[1-(5-chlorothiophen-2-yl)-1-oxopropan-2-yl]sulfanyl-N-propylacetamide (PubChem CID 114234090) has the molecular formula C12H16ClNO2S2 and a molecular weight of 305.85 g/mol. Its IUPAC name is 2-[1-(5-chlorothiophen-2-yl)-1-oxopropan-2-yl]sulfanyl-N-propylacetamide.
| Compound Name | 2-[1-(5-chlorothiophen-2-yl)-1-oxopropan-2-yl]sulfanyl-N-propylacetamide |
|---|---|
| PubChem CID | 114234090 |
| Molecular Formula | C12H16ClNO2S2 |
| Molecular Weight | 305.85 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 2-[1-(5-chlorothiophen-2-yl)-1-oxopropan-2-yl]sulfanyl-N-propylacetamide |
| SMILES | CCCNC(=O)CSC(C)C(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C12H16ClNO2S2/c1-3-6-14-11(15)7-17-8(2)12(16)9-4-5-10(13)18-9/h4-5,8H,3,6-7H2,1-2H3,(H,14,15) |
| InChIKey | KCMWUHVMEIHJGS-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.85 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |