C7H5Cl3OS — CID 82117947
2,3-dichloro-1-(5-chlorothiophen-2-yl)propan-1-one (PubChem CID 82117947) has the molecular formula C7H5Cl3OS and a molecular weight of 243.54 g/mol. Its IUPAC name is 2,3-dichloro-1-(5-chlorothiophen-2-yl)propan-1-one.
| Compound Name | 2,3-dichloro-1-(5-chlorothiophen-2-yl)propan-1-one |
|---|---|
| PubChem CID | 82117947 |
| Molecular Formula | C7H5Cl3OS |
| Molecular Weight | 243.54 g/mol |
| Exact Mass | 241.91 |
| IUPAC Name | 2,3-dichloro-1-(5-chlorothiophen-2-yl)propan-1-one |
| SMILES | O=C(c1ccc(Cl)s1)C(Cl)CCl |
| InChI | InChI=1S/C7H5Cl3OS/c8-3-4(9)7(11)5-1-2-6(10)12-5/h1-2,4H,3H2 |
| InChIKey | CCURHFMWHTTXPH-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.54 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|