5-chlorothiophene-2-carbonyl fluoride

C5H2ClFOS — CID 119084238

IUPAC5-chlorothiophene-2-carbonyl fluoride
SMILESO=C(F)c1ccc(Cl)s1
InChIInChI=1S/C5H2ClFOS/c6-4-2-1-3(9-4)5(7)8/h1-2H
InChIKeyYKAWLXOEKLHBIJ-UHFFFAOYSA-N
MW164.59 g/mol
LogP2.51
Rot. Bonds1

About 5-chlorothiophene-2-carbonyl fluoride

5-chlorothiophene-2-carbonyl fluoride (PubChem CID 119084238) has the molecular formula C5H2ClFOS and a molecular weight of 164.59 g/mol. Its IUPAC name is 5-chlorothiophene-2-carbonyl fluoride.

Molecular Properties

Compound Name5-chlorothiophene-2-carbonyl fluoride
PubChem CID119084238
Molecular FormulaC5H2ClFOS
Molecular Weight164.59 g/mol
Exact Mass163.95
IUPAC Name5-chlorothiophene-2-carbonyl fluoride
SMILESO=C(F)c1ccc(Cl)s1
InChIInChI=1S/C5H2ClFOS/c6-4-2-1-3(9-4)5(7)8/h1-2H
InChIKeyYKAWLXOEKLHBIJ-UHFFFAOYSA-N
XLogP2.51
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500164.59
LogP ≤ 52.51
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 5-chlorothiophene-2-carbonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-chlorothiophene-2-carbonyl fluoride?
The IUPAC name of 5-chlorothiophene-2-carbonyl fluoride (CID 119084238) is 5-chlorothiophene-2-carbonyl fluoride.
What is the SMILES notation for 5-chlorothiophene-2-carbonyl fluoride?
The canonical SMILES for 5-chlorothiophene-2-carbonyl fluoride is O=C(F)c1ccc(Cl)s1.
What is the InChIKey of 5-chlorothiophene-2-carbonyl fluoride?
The InChIKey is YKAWLXOEKLHBIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H2ClFOS/c6-4-2-1-3(9-4)5(7)8/h1-2H.
What are the key properties of 5-chlorothiophene-2-carbonyl fluoride?
5-chlorothiophene-2-carbonyl fluoride has a molecular weight of 164.59 g/mol, XLogP of 2.51, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chlorothiophene-2-carbonyl fluoride is sourced from PubChem (CID 119084238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).