C10H12ClNO2S — CID 64994287
5-chloro-N-(3-methyl-2-oxobutyl)thiophene-2-carboxamide (PubChem CID 64994287) has the molecular formula C10H12ClNO2S and a molecular weight of 245.73 g/mol. Its IUPAC name is 5-chloro-N-(3-methyl-2-oxobutyl)thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-(3-methyl-2-oxobutyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 64994287 |
| Molecular Formula | C10H12ClNO2S |
| Molecular Weight | 245.73 g/mol |
| Exact Mass | 245.03 |
| IUPAC Name | 5-chloro-N-(3-methyl-2-oxobutyl)thiophene-2-carboxamide |
| SMILES | CC(C)C(=O)CNC(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C10H12ClNO2S/c1-6(2)7(13)5-12-10(14)8-3-4-9(11)15-8/h3-4,6H,5H2,1-2H3,(H,12,14) |
| InChIKey | ZXKODZWCAJOEGA-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.73 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |