C11H14ClNOS — CID 143722959
5-chloro-N-prop-2-ynylthiophene-2-carboxamide;propane (PubChem CID 143722959) has the molecular formula C11H14ClNOS and a molecular weight of 243.76 g/mol. Its IUPAC name is 5-chloro-N-prop-2-ynylthiophene-2-carboxamide;propane.
| Compound Name | 5-chloro-N-prop-2-ynylthiophene-2-carboxamide;propane |
|---|---|
| PubChem CID | 143722959 |
| Molecular Formula | C11H14ClNOS |
| Molecular Weight | 243.76 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 5-chloro-N-prop-2-ynylthiophene-2-carboxamide;propane |
| SMILES | C#CCNC(=O)c1ccc(Cl)s1.CCC |
| InChI | InChI=1S/C8H6ClNOS.C3H8/c1-2-5-10-8(11)6-3-4-7(9)12-6;1-3-2/h1,3-4H,5H2,(H,10,11);3H2,1-2H3 |
| InChIKey | HOIONWAMRZXVQM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.76 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|