C9H11ClN2O2S — CID 9480604
5-chloro-N-[2-(dimethylamino)-2-oxoethyl]thiophene-2-carboxamide (PubChem CID 9480604) has the molecular formula C9H11ClN2O2S and a molecular weight of 246.72 g/mol. Its IUPAC name is 5-chloro-N-[2-(dimethylamino)-2-oxoethyl]thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-[2-(dimethylamino)-2-oxoethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 9480604 |
| Molecular Formula | C9H11ClN2O2S |
| Molecular Weight | 246.72 g/mol |
| Exact Mass | 246.02 |
| IUPAC Name | 5-chloro-N-[2-(dimethylamino)-2-oxoethyl]thiophene-2-carboxamide |
| SMILES | CN(C)C(=O)CNC(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C9H11ClN2O2S/c1-12(2)8(13)5-11-9(14)6-3-4-7(10)15-6/h3-4H,5H2,1-2H3,(H,11,14) |
| InChIKey | NPRREQJAPFFBLS-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.72 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |