C11H14ClNO2S — CID 64991724
5-chloro-N-(3,3-dimethyl-2-oxobutyl)thiophene-2-carboxamide (PubChem CID 64991724) has the molecular formula C11H14ClNO2S and a molecular weight of 259.76 g/mol. Its IUPAC name is 5-chloro-N-(3,3-dimethyl-2-oxobutyl)thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-(3,3-dimethyl-2-oxobutyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 64991724 |
| Molecular Formula | C11H14ClNO2S |
| Molecular Weight | 259.76 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | 5-chloro-N-(3,3-dimethyl-2-oxobutyl)thiophene-2-carboxamide |
| SMILES | CC(C)(C)C(=O)CNC(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C11H14ClNO2S/c1-11(2,3)8(14)6-13-10(15)7-4-5-9(12)16-7/h4-5H,6H2,1-3H3,(H,13,15) |
| InChIKey | LBQIBBAGWCEKGE-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.76 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |