C10H14ClNO2S — CID 64555417
5-chloro-N-(1-hydroxy-2-methylbutan-2-yl)thiophene-2-carboxamide (PubChem CID 64555417) has the molecular formula C10H14ClNO2S and a molecular weight of 247.75 g/mol. Its IUPAC name is 5-chloro-N-(1-hydroxy-2-methylbutan-2-yl)thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-(1-hydroxy-2-methylbutan-2-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 64555417 |
| Molecular Formula | C10H14ClNO2S |
| Molecular Weight | 247.75 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | 5-chloro-N-(1-hydroxy-2-methylbutan-2-yl)thiophene-2-carboxamide |
| SMILES | CCC(C)(CO)NC(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C10H14ClNO2S/c1-3-10(2,6-13)12-9(14)7-4-5-8(11)15-7/h4-5,13H,3,6H2,1-2H3,(H,12,14) |
| InChIKey | MJRLCNGLAMTWAF-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.75 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |