C11H14ClNO5S — CID 67456065
2-[(5-chlorothiophene-2-carbonyl)amino]-3-methoxy-2-(methoxymethyl)propanoic acid (PubChem CID 67456065) has the molecular formula C11H14ClNO5S and a molecular weight of 307.75 g/mol. Its IUPAC name is 2-[(5-chlorothiophene-2-carbonyl)amino]-3-methoxy-2-(methoxymethyl)propanoic acid.
| Compound Name | 2-[(5-chlorothiophene-2-carbonyl)amino]-3-methoxy-2-(methoxymethyl)propanoic acid |
|---|---|
| PubChem CID | 67456065 |
| Molecular Formula | C11H14ClNO5S |
| Molecular Weight | 307.75 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | 2-[(5-chlorothiophene-2-carbonyl)amino]-3-methoxy-2-(methoxymethyl)propanoic acid |
| SMILES | COCC(COC)(NC(=O)c1ccc(Cl)s1)C(=O)O |
| InChI | InChI=1S/C11H14ClNO5S/c1-17-5-11(6-18-2,10(15)16)13-9(14)7-3-4-8(12)19-7/h3-4H,5-6H2,1-2H3,(H,13,14)(H,15,16) |
| InChIKey | BSMBOVKNDITCBN-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.75 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |