C10H11ClO3S — CID 116919231
methyl 3-(5-chlorothiophen-2-yl)-2,2-dimethyl-3-oxopropanoate (PubChem CID 116919231) has the molecular formula C10H11ClO3S and a molecular weight of 246.71 g/mol. Its IUPAC name is methyl 3-(5-chlorothiophen-2-yl)-2,2-dimethyl-3-oxopropanoate.
| Compound Name | methyl 3-(5-chlorothiophen-2-yl)-2,2-dimethyl-3-oxopropanoate |
|---|---|
| PubChem CID | 116919231 |
| Molecular Formula | C10H11ClO3S |
| Molecular Weight | 246.71 g/mol |
| Exact Mass | 246.01 |
| IUPAC Name | methyl 3-(5-chlorothiophen-2-yl)-2,2-dimethyl-3-oxopropanoate |
| SMILES | COC(=O)C(C)(C)C(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C10H11ClO3S/c1-10(2,9(13)14-3)8(12)6-4-5-7(11)15-6/h4-5H,1-3H3 |
| InChIKey | VSQBHBDYFCNHFQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.71 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|