C12H16ClNO5S — CID 67455828
methyl 2-[(5-chlorothiophene-2-carbonyl)amino]-3-(2-methoxyethoxy)propanoate (PubChem CID 67455828) has the molecular formula C12H16ClNO5S and a molecular weight of 321.78 g/mol. Its IUPAC name is methyl 2-[(5-chlorothiophene-2-carbonyl)amino]-3-(2-methoxyethoxy)propanoate.
| Compound Name | methyl 2-[(5-chlorothiophene-2-carbonyl)amino]-3-(2-methoxyethoxy)propanoate |
|---|---|
| PubChem CID | 67455828 |
| Molecular Formula | C12H16ClNO5S |
| Molecular Weight | 321.78 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | methyl 2-[(5-chlorothiophene-2-carbonyl)amino]-3-(2-methoxyethoxy)propanoate |
| SMILES | COCCOCC(NC(=O)c1ccc(Cl)s1)C(=O)OC |
| InChI | InChI=1S/C12H16ClNO5S/c1-17-5-6-19-7-8(12(16)18-2)14-11(15)9-3-4-10(13)20-9/h3-4,8H,5-7H2,1-2H3,(H,14,15) |
| InChIKey | NTFVJQVJACIDIL-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.78 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|