C18H20ClN2OS2+ — CID 8653891
(2R)-3-(5-chlorothiophen-2-yl)-3-oxo-N-prop-2-enyl-2-(4-propylpyridin-1-ium-1-yl)propanethioamide (PubChem CID 8653891) has the molecular formula C18H20ClN2OS2+ and a molecular weight of 379.96 g/mol. Its IUPAC name is (2R)-3-(5-chlorothiophen-2-yl)-3-oxo-N-prop-2-enyl-2-(4-propylpyridin-1-ium-1-yl)propanethioamide.
| Compound Name | (2R)-3-(5-chlorothiophen-2-yl)-3-oxo-N-prop-2-enyl-2-(4-propylpyridin-1-ium-1-yl)propanethioamide |
|---|---|
| PubChem CID | 8653891 |
| Molecular Formula | C18H20ClN2OS2+ |
| Molecular Weight | 379.96 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | (2R)-3-(5-chlorothiophen-2-yl)-3-oxo-N-prop-2-enyl-2-(4-propylpyridin-1-ium-1-yl)propanethioamide |
| SMILES | C=CCNC(=S)[C@@H](C(=O)c1ccc(Cl)s1)[n+]1ccc(CCC)cc1 |
| InChI | InChI=1S/C18H19ClN2OS2/c1-3-5-13-8-11-21(12-9-13)16(18(23)20-10-4-2)17(22)14-6-7-15(19)24-14/h4,6-9,11-12,16H,2-3,5,10H2,1H3/p+1/t16-/m1/s1 |
| InChIKey | CJVDSUAAYQAMCF-MRXNPFEDSA-O |
| XLogP | 4.17 |
| TPSA | 32.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.96 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|