C20H21N2O2S2+ — CID 135761599
(2S)-N-(furan-2-ylmethyl)-3-oxo-2-(4-propylpyridin-1-ium-1-yl)-3-thiophen-2-ylpropanethioamide (PubChem CID 135761599) has the molecular formula C20H21N2O2S2+ and a molecular weight of 385.53 g/mol. Its IUPAC name is (2S)-N-(furan-2-ylmethyl)-3-oxo-2-(4-propylpyridin-1-ium-1-yl)-3-thiophen-2-ylpropanethioamide.
| Compound Name | (2S)-N-(furan-2-ylmethyl)-3-oxo-2-(4-propylpyridin-1-ium-1-yl)-3-thiophen-2-ylpropanethioamide |
|---|---|
| PubChem CID | 135761599 |
| Molecular Formula | C20H21N2O2S2+ |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | (2S)-N-(furan-2-ylmethyl)-3-oxo-2-(4-propylpyridin-1-ium-1-yl)-3-thiophen-2-ylpropanethioamide |
| SMILES | CCCc1cc[n+]([C@@H](C(=O)c2cccs2)C(=S)NCc2ccco2)cc1 |
| InChI | InChI=1S/C20H20N2O2S2/c1-2-5-15-8-10-22(11-9-15)18(19(23)17-7-4-13-26-17)20(25)21-14-16-6-3-12-24-16/h3-4,6-13,18H,2,5,14H2,1H3/p+1/t18-/m0/s1 |
| InChIKey | NRRQSESVHHTFJL-SFHVURJKSA-O |
| XLogP | 4.12 |
| TPSA | 46.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|