C19H15ClN2OS2 — CID 7938559
N-benzyl-3-(5-chlorothiophen-2-yl)-3-oxo-2-pyridin-1-ium-1-ylpropanimidothioate (PubChem CID 7938559) has the molecular formula C19H15ClN2OS2 and a molecular weight of 386.93 g/mol. Its IUPAC name is N-benzyl-3-(5-chlorothiophen-2-yl)-3-oxo-2-pyridin-1-ium-1-ylpropanimidothioate.
| Compound Name | N-benzyl-3-(5-chlorothiophen-2-yl)-3-oxo-2-pyridin-1-ium-1-ylpropanimidothioate |
|---|---|
| PubChem CID | 7938559 |
| Molecular Formula | C19H15ClN2OS2 |
| Molecular Weight | 386.93 g/mol |
| Exact Mass | 386.03 |
| IUPAC Name | N-benzyl-3-(5-chlorothiophen-2-yl)-3-oxo-2-pyridin-1-ium-1-ylpropanimidothioate |
| SMILES | O=C(c1ccc(Cl)s1)C(/C([S-])=N/Cc1ccccc1)[n+]1ccccc1 |
| InChI | InChI=1S/C19H15ClN2OS2/c20-16-10-9-15(25-16)18(23)17(22-11-5-2-6-12-22)19(24)21-13-14-7-3-1-4-8-14/h1-12,17H,13H2 |
| InChIKey | PBAKRLYKVVLATR-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 33.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.93 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|