C23H22N2OS — CID 135761536
(2R)-N-benzyl-3-(4-ethylphenyl)-3-oxo-2-pyridin-1-ium-1-ylpropanimidothioate (PubChem CID 135761536) has the molecular formula C23H22N2OS and a molecular weight of 374.51 g/mol. Its IUPAC name is (2R)-N-benzyl-3-(4-ethylphenyl)-3-oxo-2-pyridin-1-ium-1-ylpropanimidothioate.
| Compound Name | (2R)-N-benzyl-3-(4-ethylphenyl)-3-oxo-2-pyridin-1-ium-1-ylpropanimidothioate |
|---|---|
| PubChem CID | 135761536 |
| Molecular Formula | C23H22N2OS |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | (2R)-N-benzyl-3-(4-ethylphenyl)-3-oxo-2-pyridin-1-ium-1-ylpropanimidothioate |
| SMILES | CCc1ccc(C(=O)[C@H](/C([S-])=N/Cc2ccccc2)[n+]2ccccc2)cc1 |
| InChI | InChI=1S/C23H22N2OS/c1-2-18-11-13-20(14-12-18)22(26)21(25-15-7-4-8-16-25)23(27)24-17-19-9-5-3-6-10-19/h3-16,21H,2,17H2,1H3/t21-/m1/s1 |
| InChIKey | ZIPSDYGCBKTRSR-OAQYLSRUSA-N |
| XLogP | 4.11 |
| TPSA | 33.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|