C18H16F2N2O2S — CID 7481378
3-[4-(difluoromethoxy)phenyl]-3-oxo-N-prop-2-enyl-2-pyridin-1-ium-1-ylpropanimidothioate (PubChem CID 7481378) has the molecular formula C18H16F2N2O2S and a molecular weight of 362.40 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)phenyl]-3-oxo-N-prop-2-enyl-2-pyridin-1-ium-1-ylpropanimidothioate.
| Compound Name | 3-[4-(difluoromethoxy)phenyl]-3-oxo-N-prop-2-enyl-2-pyridin-1-ium-1-ylpropanimidothioate |
|---|---|
| PubChem CID | 7481378 |
| Molecular Formula | C18H16F2N2O2S |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 3-[4-(difluoromethoxy)phenyl]-3-oxo-N-prop-2-enyl-2-pyridin-1-ium-1-ylpropanimidothioate |
| SMILES | C=CC/N=C(\[S-])C(C(=O)c1ccc(OC(F)F)cc1)[n+]1ccccc1 |
| InChI | InChI=1S/C18H16F2N2O2S/c1-2-10-21-17(25)15(22-11-4-3-5-12-22)16(23)13-6-8-14(9-7-13)24-18(19)20/h2-9,11-12,15,18H,1,10H2 |
| InChIKey | VHYKGYZFVVRKAE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 42.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|