C21H23FN2OS — CID 7912722
(2R)-2-(4-tert-butylpyridin-1-ium-1-yl)-3-(4-fluorophenyl)-3-oxo-N-prop-2-enylpropanimidothioate (PubChem CID 7912722) has the molecular formula C21H23FN2OS and a molecular weight of 370.49 g/mol. Its IUPAC name is (2R)-2-(4-tert-butylpyridin-1-ium-1-yl)-3-(4-fluorophenyl)-3-oxo-N-prop-2-enylpropanimidothioate.
| Compound Name | (2R)-2-(4-tert-butylpyridin-1-ium-1-yl)-3-(4-fluorophenyl)-3-oxo-N-prop-2-enylpropanimidothioate |
|---|---|
| PubChem CID | 7912722 |
| Molecular Formula | C21H23FN2OS |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | (2R)-2-(4-tert-butylpyridin-1-ium-1-yl)-3-(4-fluorophenyl)-3-oxo-N-prop-2-enylpropanimidothioate |
| SMILES | C=CC/N=C(\[S-])[C@@H](C(=O)c1ccc(F)cc1)[n+]1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H23FN2OS/c1-5-12-23-20(26)18(19(25)15-6-8-17(22)9-7-15)24-13-10-16(11-14-24)21(2,3)4/h5-11,13-14,18H,1,12H2,2-4H3/t18-/m1/s1 |
| InChIKey | DFGSTVYQVADEFF-GOSISDBHSA-N |
| XLogP | 3.97 |
| TPSA | 33.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|