C10H13N3S2 — CID 2792561
1-prop-2-enyl-3-(1-thiophen-2-ylethylideneamino)thiourea (PubChem CID 2792561) has the molecular formula C10H13N3S2 and a molecular weight of 239.37 g/mol. Its IUPAC name is 1-prop-2-enyl-3-(1-thiophen-2-ylethylideneamino)thiourea.
| Compound Name | 1-prop-2-enyl-3-(1-thiophen-2-ylethylideneamino)thiourea |
|---|---|
| PubChem CID | 2792561 |
| Molecular Formula | C10H13N3S2 |
| Molecular Weight | 239.37 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 1-prop-2-enyl-3-(1-thiophen-2-ylethylideneamino)thiourea |
| SMILES | C=CCNC(=S)NN=C(C)c1cccs1 |
| InChI | InChI=1S/C10H13N3S2/c1-3-6-11-10(14)13-12-8(2)9-5-4-7-15-9/h3-5,7H,1,6H2,2H3,(H2,11,13,14) |
| InChIKey | STCNTWPFXSDDHJ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.37 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|