C14H21N3O2S2 — CID 9350379
methyl 6-[[(Z)-1-thiophen-2-ylethylideneamino]carbamothioylamino]hexanoate (PubChem CID 9350379) has the molecular formula C14H21N3O2S2 and a molecular weight of 327.47 g/mol. Its IUPAC name is methyl 6-[[(Z)-1-thiophen-2-ylethylideneamino]carbamothioylamino]hexanoate.
| Compound Name | methyl 6-[[(Z)-1-thiophen-2-ylethylideneamino]carbamothioylamino]hexanoate |
|---|---|
| PubChem CID | 9350379 |
| Molecular Formula | C14H21N3O2S2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | methyl 6-[[(Z)-1-thiophen-2-ylethylideneamino]carbamothioylamino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=S)N/N=C(/C)c1cccs1 |
| InChI | InChI=1S/C14H21N3O2S2/c1-11(12-7-6-10-21-12)16-17-14(20)15-9-5-3-4-8-13(18)19-2/h6-7,10H,3-5,8-9H2,1-2H3,(H2,15,17,20)/b16-11- |
| InChIKey | KXVMLOXIPIYDCN-WJDWOHSUSA-N |
| XLogP | 2.67 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|