C15H14FN3O4 — CID 135575936
N'-[(E)-1-(5-fluoro-2-hydroxyphenyl)ethylideneamino]-N-(furan-2-ylmethyl)oxamide (PubChem CID 135575936) has the molecular formula C15H14FN3O4 and a molecular weight of 319.29 g/mol. Its IUPAC name is N'-[(E)-1-(5-fluoro-2-hydroxyphenyl)ethylideneamino]-N-(furan-2-ylmethyl)oxamide.
| Compound Name | N'-[(E)-1-(5-fluoro-2-hydroxyphenyl)ethylideneamino]-N-(furan-2-ylmethyl)oxamide |
|---|---|
| PubChem CID | 135575936 |
| Molecular Formula | C15H14FN3O4 |
| Molecular Weight | 319.29 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | N'-[(E)-1-(5-fluoro-2-hydroxyphenyl)ethylideneamino]-N-(furan-2-ylmethyl)oxamide |
| SMILES | C/C(=N\NC(=O)C(=O)NCc1ccco1)c1cc(F)ccc1O |
| InChI | InChI=1S/C15H14FN3O4/c1-9(12-7-10(16)4-5-13(12)20)18-19-15(22)14(21)17-8-11-3-2-6-23-11/h2-7,20H,8H2,1H3,(H,17,21)(H,19,22)/b18-9+ |
| InChIKey | JEDGXLAPGLWRBI-GIJQJNRQSA-N |
| XLogP | 1.28 |
| TPSA | 103.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.29 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|