C23H21BrO5S — CID 10624885
[2-[(1R,2R)-2-bromo-1-methoxy-3-oxo-3-phenylpropyl]phenyl] 4-methylbenzenesulfonate (PubChem CID 10624885) has the molecular formula C23H21BrO5S and a molecular weight of 489.39 g/mol. Its IUPAC name is [2-[(1R,2R)-2-bromo-1-methoxy-3-oxo-3-phenylpropyl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [2-[(1R,2R)-2-bromo-1-methoxy-3-oxo-3-phenylpropyl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10624885 |
| Molecular Formula | C23H21BrO5S |
| Molecular Weight | 489.39 g/mol |
| Exact Mass | 488.03 |
| IUPAC Name | [2-[(1R,2R)-2-bromo-1-methoxy-3-oxo-3-phenylpropyl]phenyl] 4-methylbenzenesulfonate |
| SMILES | CO[C@H](c1ccccc1OS(=O)(=O)c1ccc(C)cc1)[C@@H](Br)C(=O)c1ccccc1 |
| InChI | InChI=1S/C23H21BrO5S/c1-16-12-14-18(15-13-16)30(26,27)29-20-11-7-6-10-19(20)23(28-2)21(24)22(25)17-8-4-3-5-9-17/h3-15,21,23H,1-2H3/t21-,23+/m0/s1 |
| InChIKey | LSJMOWOVAUIRIJ-JTHBVZDNSA-N |
| XLogP | 5.10 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.39 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|