C23H23NO4S — CID 23034221
[2-(2-benzamidopropyl)phenyl] 4-methylbenzenesulfonate (PubChem CID 23034221) has the molecular formula C23H23NO4S and a molecular weight of 409.51 g/mol. Its IUPAC name is [2-(2-benzamidopropyl)phenyl] 4-methylbenzenesulfonate.
| Compound Name | [2-(2-benzamidopropyl)phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 23034221 |
| Molecular Formula | C23H23NO4S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | [2-(2-benzamidopropyl)phenyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccccc2CC(C)NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H23NO4S/c1-17-12-14-21(15-13-17)29(26,27)28-22-11-7-6-10-20(22)16-18(2)24-23(25)19-8-4-3-5-9-19/h3-15,18H,16H2,1-2H3,(H,24,25) |
| InChIKey | XRUGZDJNTXXNHB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|