About CID 158715542
CID 158715542 (PubChem CID 158715542) has the molecular formula C18H30CaO3S
and a molecular weight of 366.58 g/mol.
Molecular Properties
| Compound Name | CID 158715542 |
| PubChem CID | 158715542 |
| Molecular Formula | C18H30CaO3S |
| Molecular Weight | 366.58 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | — |
| SMILES | CCCCCCCCCC(CC)OS(=O)(=O)c1ccccc1.[Ca] |
| InChI | InChI=1S/C18H30O3S.Ca/c1-3-5-6-7-8-9-11-14-17(4-2)21-22(19,20)18-15-12-10-13-16-18;/h10,12-13,15-17H,3-9,11,14H2,1-2H3; |
| InChIKey | IJGKQXLTPDXORI-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.58 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze CID 158715542 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 158715542?
The IUPAC name of CID 158715542 (CID 158715542) is not available.
What is the SMILES notation for CID 158715542?
The canonical SMILES for CID 158715542 is CCCCCCCCCC(CC)OS(=O)(=O)c1ccccc1.[Ca].
What is the InChIKey of CID 158715542?
The InChIKey is IJGKQXLTPDXORI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30O3S.Ca/c1-3-5-6-7-8-9-11-14-17(4-2)21-22(19,20)18-15-12-10-13-16-18;/h10,12-13,15-17H,3-9,11,14H2,1-2H3;.
What are the key properties of CID 158715542?
CID 158715542 has a molecular weight of 366.58 g/mol, XLogP of 4.93, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 158715542 is sourced from PubChem (CID 158715542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).