C10H13ClO4S — CID 88751491
[(2R)-1-chloro-3-hydroxypropan-2-yl] 4-methylbenzenesulfonate (PubChem CID 88751491) has the molecular formula C10H13ClO4S and a molecular weight of 264.73 g/mol. Its IUPAC name is [(2R)-1-chloro-3-hydroxypropan-2-yl] 4-methylbenzenesulfonate.
| Compound Name | [(2R)-1-chloro-3-hydroxypropan-2-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 88751491 |
| Molecular Formula | C10H13ClO4S |
| Molecular Weight | 264.73 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | [(2R)-1-chloro-3-hydroxypropan-2-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H](CO)CCl)cc1 |
| InChI | InChI=1S/C10H13ClO4S/c1-8-2-4-10(5-3-8)16(13,14)15-9(6-11)7-12/h2-5,9,12H,6-7H2,1H3/t9-/m0/s1 |
| InChIKey | VSIAAEOUSBBYQP-VIFPVBQESA-N |
| XLogP | 1.30 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.73 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|