C15H14Cl2O3S — CID 90462706
1-(3,5-dichlorophenyl)ethyl 4-methylbenzenesulfonate (PubChem CID 90462706) has the molecular formula C15H14Cl2O3S and a molecular weight of 345.25 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)ethyl 4-methylbenzenesulfonate.
| Compound Name | 1-(3,5-dichlorophenyl)ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 90462706 |
| Molecular Formula | C15H14Cl2O3S |
| Molecular Weight | 345.25 g/mol |
| Exact Mass | 344.00 |
| IUPAC Name | 1-(3,5-dichlorophenyl)ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC(C)c2cc(Cl)cc(Cl)c2)cc1 |
| InChI | InChI=1S/C15H14Cl2O3S/c1-10-3-5-15(6-4-10)21(18,19)20-11(2)12-7-13(16)9-14(17)8-12/h3-9,11H,1-2H3 |
| InChIKey | FZNSPXZCQZYDQJ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.25 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|