C15H23NO5S — CID 67674138
tert-butyl N-(1-hydroxy-3-methylsulfonyl-1-phenylpropan-2-yl)carbamate (PubChem CID 67674138) has the molecular formula C15H23NO5S and a molecular weight of 329.42 g/mol. Its IUPAC name is tert-butyl N-(1-hydroxy-3-methylsulfonyl-1-phenylpropan-2-yl)carbamate.
| Compound Name | tert-butyl N-(1-hydroxy-3-methylsulfonyl-1-phenylpropan-2-yl)carbamate |
|---|---|
| PubChem CID | 67674138 |
| Molecular Formula | C15H23NO5S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | tert-butyl N-(1-hydroxy-3-methylsulfonyl-1-phenylpropan-2-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CS(C)(=O)=O)C(O)c1ccccc1 |
| InChI | InChI=1S/C15H23NO5S/c1-15(2,3)21-14(18)16-12(10-22(4,19)20)13(17)11-8-6-5-7-9-11/h5-9,12-13,17H,10H2,1-4H3,(H,16,18) |
| InChIKey | ADQNIHQPJMXTAI-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |