C21H33NO5S — CID 57229751
tert-butyl N-[3-methyl-1-[(1S,2S)-2-methyl-3-oxo-1-phenylpropyl]sulfonylpentan-2-yl]carbamate (PubChem CID 57229751) has the molecular formula C21H33NO5S and a molecular weight of 411.56 g/mol. Its IUPAC name is tert-butyl N-[3-methyl-1-[(1S,2S)-2-methyl-3-oxo-1-phenylpropyl]sulfonylpentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[3-methyl-1-[(1S,2S)-2-methyl-3-oxo-1-phenylpropyl]sulfonylpentan-2-yl]carbamate |
|---|---|
| PubChem CID | 57229751 |
| Molecular Formula | C21H33NO5S |
| Molecular Weight | 411.56 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | tert-butyl N-[3-methyl-1-[(1S,2S)-2-methyl-3-oxo-1-phenylpropyl]sulfonylpentan-2-yl]carbamate |
| SMILES | CCC(C)C(CS(=O)(=O)[C@H](c1ccccc1)C(C)C=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H33NO5S/c1-7-15(2)18(22-20(24)27-21(4,5)6)14-28(25,26)19(16(3)13-23)17-11-9-8-10-12-17/h8-13,15-16,18-19H,7,14H2,1-6H3,(H,22,24)/t15?,16?,18?,19-/m0/s1 |
| InChIKey | LWPNUJVKSFOELQ-WEFHOXGESA-N |
| XLogP | 3.92 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.56 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|