C24H25N3O4S — CID 31516554
tert-butyl N-[[4-[[3-(thiophene-2-carbonylamino)phenyl]carbamoyl]phenyl]methyl]carbamate (PubChem CID 31516554) has the molecular formula C24H25N3O4S and a molecular weight of 451.55 g/mol. Its IUPAC name is tert-butyl N-[[4-[[3-(thiophene-2-carbonylamino)phenyl]carbamoyl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[[3-(thiophene-2-carbonylamino)phenyl]carbamoyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 31516554 |
| Molecular Formula | C24H25N3O4S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | tert-butyl N-[[4-[[3-(thiophene-2-carbonylamino)phenyl]carbamoyl]phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1ccc(C(=O)Nc2cccc(NC(=O)c3cccs3)c2)cc1 |
| InChI | InChI=1S/C24H25N3O4S/c1-24(2,3)31-23(30)25-15-16-9-11-17(12-10-16)21(28)26-18-6-4-7-19(14-18)27-22(29)20-8-5-13-32-20/h4-14H,15H2,1-3H3,(H,25,30)(H,26,28)(H,27,29) |
| InChIKey | CQICEDBMWIRJJF-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |