C18H12O8 — CID 141181018
4-[2-(2,4-dicarboxyphenyl)ethenyl]benzene-1,3-dicarboxylic acid (PubChem CID 141181018) has the molecular formula C18H12O8 and a molecular weight of 356.29 g/mol. Its IUPAC name is 4-[2-(2,4-dicarboxyphenyl)ethenyl]benzene-1,3-dicarboxylic acid.
| Compound Name | 4-[2-(2,4-dicarboxyphenyl)ethenyl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 141181018 |
| Molecular Formula | C18H12O8 |
| Molecular Weight | 356.29 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | 4-[2-(2,4-dicarboxyphenyl)ethenyl]benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1ccc(C=Cc2ccc(C(=O)O)cc2C(=O)O)c(C(=O)O)c1 |
| InChI | InChI=1S/C18H12O8/c19-15(20)11-5-3-9(13(7-11)17(23)24)1-2-10-4-6-12(16(21)22)8-14(10)18(25)26/h1-8H,(H,19,20)(H,21,22)(H,23,24)(H,25,26) |
| InChIKey | JKXSJRPOSOSUHI-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.29 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|