C9H7NO5 — CID 143094529
4-(hydroxyiminomethyl)benzene-1,3-dicarboxylic acid (PubChem CID 143094529) has the molecular formula C9H7NO5 and a molecular weight of 209.16 g/mol. Its IUPAC name is 4-(hydroxyiminomethyl)benzene-1,3-dicarboxylic acid.
| Compound Name | 4-(hydroxyiminomethyl)benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 143094529 |
| Molecular Formula | C9H7NO5 |
| Molecular Weight | 209.16 g/mol |
| Exact Mass | 209.03 |
| IUPAC Name | 4-(hydroxyiminomethyl)benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1ccc(C=NO)c(C(=O)O)c1 |
| InChI | InChI=1S/C9H7NO5/c11-8(12)5-1-2-6(4-10-15)7(3-5)9(13)14/h1-4,15H,(H,11,12)(H,13,14) |
| InChIKey | KXPCPKACXFXNTP-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.16 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|