C9H6N2O4 — CID 136948222
2-[(E)-hydroxyiminomethyl]-1,3-benzoxazole-5-carboxylic acid (PubChem CID 136948222) has the molecular formula C9H6N2O4 and a molecular weight of 206.16 g/mol. Its IUPAC name is 2-[(E)-hydroxyiminomethyl]-1,3-benzoxazole-5-carboxylic acid.
| Compound Name | 2-[(E)-hydroxyiminomethyl]-1,3-benzoxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 136948222 |
| Molecular Formula | C9H6N2O4 |
| Molecular Weight | 206.16 g/mol |
| Exact Mass | 206.03 |
| IUPAC Name | 2-[(E)-hydroxyiminomethyl]-1,3-benzoxazole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2oc(/C=N/O)nc2c1 |
| InChI | InChI=1S/C9H6N2O4/c12-9(13)5-1-2-7-6(3-5)11-8(15-7)4-10-14/h1-4,14H,(H,12,13)/b10-4+ |
| InChIKey | YFVYIFFNZGTWLN-ONNFQVAWSA-N |
| XLogP | 1.33 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.16 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|