C9H8N2O3 — CID 83829974
2-(methylamino)-1,3-benzoxazole-5-carboxylic acid (PubChem CID 83829974) has the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. Its IUPAC name is 2-(methylamino)-1,3-benzoxazole-5-carboxylic acid.
| Compound Name | 2-(methylamino)-1,3-benzoxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 83829974 |
| Molecular Formula | C9H8N2O3 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 2-(methylamino)-1,3-benzoxazole-5-carboxylic acid |
| SMILES | CNc1nc2cc(C(=O)O)ccc2o1 |
| InChI | InChI=1S/C9H8N2O3/c1-10-9-11-6-4-5(8(12)13)2-3-7(6)14-9/h2-4H,1H3,(H,10,11)(H,12,13) |
| InChIKey | SERMMEJHTPXPKM-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |