C11H10O5 — CID 169454037
4-(3-hydroxyprop-1-enyl)benzene-1,3-dicarboxylic acid (PubChem CID 169454037) has the molecular formula C11H10O5 and a molecular weight of 222.20 g/mol. Its IUPAC name is 4-(3-hydroxyprop-1-enyl)benzene-1,3-dicarboxylic acid.
| Compound Name | 4-(3-hydroxyprop-1-enyl)benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 169454037 |
| Molecular Formula | C11H10O5 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | 4-(3-hydroxyprop-1-enyl)benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1ccc(C=CCO)c(C(=O)O)c1 |
| InChI | InChI=1S/C11H10O5/c12-5-1-2-7-3-4-8(10(13)14)6-9(7)11(15)16/h1-4,6,12H,5H2,(H,13,14)(H,15,16) |
| InChIKey | RQLXRYMOVAYUJZ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |