C21H16Cl2O3 — CID 139758970
3,5-bis[(2-chlorophenyl)methyl]-2-hydroxybenzoic acid (PubChem CID 139758970) has the molecular formula C21H16Cl2O3 and a molecular weight of 387.26 g/mol. Its IUPAC name is 3,5-bis[(2-chlorophenyl)methyl]-2-hydroxybenzoic acid.
| Compound Name | 3,5-bis[(2-chlorophenyl)methyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 139758970 |
| Molecular Formula | C21H16Cl2O3 |
| Molecular Weight | 387.26 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | 3,5-bis[(2-chlorophenyl)methyl]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1cc(Cc2ccccc2Cl)cc(Cc2ccccc2Cl)c1O |
| InChI | InChI=1S/C21H16Cl2O3/c22-18-7-3-1-5-14(18)9-13-10-16(20(24)17(11-13)21(25)26)12-15-6-2-4-8-19(15)23/h1-8,10-11,24H,9,12H2,(H,25,26) |
| InChIKey | QAIJSRQERBCWII-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.26 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |