C12H16F3N — CID 82534567
5,5,5-trifluoro-3-(4-methylphenyl)pentan-1-amine (PubChem CID 82534567) has the molecular formula C12H16F3N and a molecular weight of 231.26 g/mol. Its IUPAC name is 5,5,5-trifluoro-3-(4-methylphenyl)pentan-1-amine.
| Compound Name | 5,5,5-trifluoro-3-(4-methylphenyl)pentan-1-amine |
|---|---|
| PubChem CID | 82534567 |
| Molecular Formula | C12H16F3N |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | 5,5,5-trifluoro-3-(4-methylphenyl)pentan-1-amine |
| SMILES | Cc1ccc(C(CCN)CC(F)(F)F)cc1 |
| InChI | InChI=1S/C12H16F3N/c1-9-2-4-10(5-3-9)11(6-7-16)8-12(13,14)15/h2-5,11H,6-8,16H2,1H3 |
| InChIKey | KKOREQODEOHIMV-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |