About 1-fluoro-4-methylbenzene;3-methylbutan-1-amine
1-fluoro-4-methylbenzene;3-methylbutan-1-amine (PubChem CID 178163375) has the molecular formula C12H20FN
and a molecular weight of 197.30 g/mol. Its IUPAC name is 1-fluoro-4-methylbenzene;3-methylbutan-1-amine.
Molecular Properties
| Compound Name | 1-fluoro-4-methylbenzene;3-methylbutan-1-amine |
| PubChem CID | 178163375 |
| Molecular Formula | C12H20FN |
| Molecular Weight | 197.30 g/mol |
| Exact Mass | 197.16 |
| IUPAC Name | 1-fluoro-4-methylbenzene;3-methylbutan-1-amine |
| SMILES | CC(C)CCN.Cc1ccc(F)cc1 |
| InChI | InChI=1S/C7H7F.C5H13N/c1-6-2-4-7(8)5-3-6;1-5(2)3-4-6/h2-5H,1H3;5H,3-4,6H2,1-2H3 |
| InChIKey | NTIUMURQSNJQMG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.30 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-fluoro-4-methylbenzene;3-methylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-4-methylbenzene;3-methylbutan-1-amine?
The IUPAC name of 1-fluoro-4-methylbenzene;3-methylbutan-1-amine (CID 178163375) is 1-fluoro-4-methylbenzene;3-methylbutan-1-amine.
What is the SMILES notation for 1-fluoro-4-methylbenzene;3-methylbutan-1-amine?
The canonical SMILES for 1-fluoro-4-methylbenzene;3-methylbutan-1-amine is CC(C)CCN.Cc1ccc(F)cc1.
What is the InChIKey of 1-fluoro-4-methylbenzene;3-methylbutan-1-amine?
The InChIKey is NTIUMURQSNJQMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7F.C5H13N/c1-6-2-4-7(8)5-3-6;1-5(2)3-4-6/h2-5H,1H3;5H,3-4,6H2,1-2H3.
What are the key properties of 1-fluoro-4-methylbenzene;3-methylbutan-1-amine?
1-fluoro-4-methylbenzene;3-methylbutan-1-amine has a molecular weight of 197.30 g/mol, XLogP of 3.13, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-4-methylbenzene;3-methylbutan-1-amine is sourced from PubChem (CID 178163375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).