C11H13F4N — CID 82534562
5,5,5-trifluoro-3-(4-fluorophenyl)pentan-1-amine (PubChem CID 82534562) has the molecular formula C11H13F4N and a molecular weight of 235.22 g/mol. Its IUPAC name is 5,5,5-trifluoro-3-(4-fluorophenyl)pentan-1-amine.
| Compound Name | 5,5,5-trifluoro-3-(4-fluorophenyl)pentan-1-amine |
|---|---|
| PubChem CID | 82534562 |
| Molecular Formula | C11H13F4N |
| Molecular Weight | 235.22 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 5,5,5-trifluoro-3-(4-fluorophenyl)pentan-1-amine |
| SMILES | NCCC(CC(F)(F)F)c1ccc(F)cc1 |
| InChI | InChI=1S/C11H13F4N/c12-10-3-1-8(2-4-10)9(5-6-16)7-11(13,14)15/h1-4,9H,5-7,16H2 |
| InChIKey | IYHNRBZTIJFTCH-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.22 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |