C10H7ClF3N — CID 72723440
2-(4-chlorophenyl)-4,4,4-trifluorobutanenitrile (PubChem CID 72723440) has the molecular formula C10H7ClF3N and a molecular weight of 233.62 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4,4,4-trifluorobutanenitrile.
| Compound Name | 2-(4-chlorophenyl)-4,4,4-trifluorobutanenitrile |
|---|---|
| PubChem CID | 72723440 |
| Molecular Formula | C10H7ClF3N |
| Molecular Weight | 233.62 g/mol |
| Exact Mass | 233.02 |
| IUPAC Name | 2-(4-chlorophenyl)-4,4,4-trifluorobutanenitrile |
| SMILES | N#CC(CC(F)(F)F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H7ClF3N/c11-9-3-1-7(2-4-9)8(6-15)5-10(12,13)14/h1-4,8H,5H2 |
| InChIKey | UBWMXPZERDWBTH-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.62 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |