C22H31NO2 — CID 177324833
3,3-dimethyl-2-[(4-phenylphenyl)methyl]butanal;ethane;formamide (PubChem CID 177324833) has the molecular formula C22H31NO2 and a molecular weight of 341.50 g/mol. Its IUPAC name is 3,3-dimethyl-2-[(4-phenylphenyl)methyl]butanal;ethane;formamide.
| Compound Name | 3,3-dimethyl-2-[(4-phenylphenyl)methyl]butanal;ethane;formamide |
|---|---|
| PubChem CID | 177324833 |
| Molecular Formula | C22H31NO2 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.24 |
| IUPAC Name | 3,3-dimethyl-2-[(4-phenylphenyl)methyl]butanal;ethane;formamide |
| SMILES | CC.CC(C)(C)C(C=O)Cc1ccc(-c2ccccc2)cc1.NC=O |
| InChI | InChI=1S/C19H22O.C2H6.CH3NO/c1-19(2,3)18(14-20)13-15-9-11-17(12-10-15)16-7-5-4-6-8-16;1-2;2-1-3/h4-12,14,18H,13H2,1-3H3;1-2H3;1H,(H2,2,3) |
| InChIKey | IYCPIEBVDJZZSI-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|