C12H14F2O — CID 105465847
2,2-difluoro-2-[4-(2-methylpropyl)phenyl]acetaldehyde (PubChem CID 105465847) has the molecular formula C12H14F2O and a molecular weight of 212.24 g/mol. Its IUPAC name is 2,2-difluoro-2-[4-(2-methylpropyl)phenyl]acetaldehyde.
| Compound Name | 2,2-difluoro-2-[4-(2-methylpropyl)phenyl]acetaldehyde |
|---|---|
| PubChem CID | 105465847 |
| Molecular Formula | C12H14F2O |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 2,2-difluoro-2-[4-(2-methylpropyl)phenyl]acetaldehyde |
| SMILES | CC(C)Cc1ccc(C(F)(F)C=O)cc1 |
| InChI | InChI=1S/C12H14F2O/c1-9(2)7-10-3-5-11(6-4-10)12(13,14)8-15/h3-6,8-9H,7H2,1-2H3 |
| InChIKey | ZMYFSSSHXNNXNH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|